C40H41N3O5 — CID 126023333
N-[(Z)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 126023333) has the molecular formula C40H41N3O5 and a molecular weight of 643.78 g/mol. Its IUPAC name is N-[(Z)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126023333 |
| Molecular Formula | C40H41N3O5 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | N-[(Z)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | COc1cc(/C=N\NC(=O)C(O)(c2ccccc2)c2ccccc2)ccc1OCC(=O)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C40H41N3O5/c1-47-36-21-27(25-41-43-38(45)40(46,32-8-4-2-5-9-32)33-10-6-3-7-11-33)12-17-35(36)48-26-37(44)42-34-15-13-31(14-16-34)39-22-28-18-29(23-39)20-30(19-28)24-39/h2-17,21,25,28-30,46H,18-20,22-24,26H2,1H3,(H,42,44)(H,43,45)/b41-25- |
| InChIKey | VNZUPZBVAJERLN-RSEYIHLLSA-N |
| XLogP | 6.57 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|