C36H37N3O5S — CID 137022958
N-[4-(1-adamantyl)phenyl]-2-[2-methoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 137022958) has the molecular formula C36H37N3O5S and a molecular weight of 623.78 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-2-[2-methoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-2-[2-methoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 137022958 |
| Molecular Formula | C36H37N3O5S |
| Molecular Weight | 623.78 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-2-[2-methoxy-4-[(E)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccc(/N=C2/NC(=O)/C(=C\c3ccc(OCC(=O)Nc4ccc(C56CC7CC(CC(C7)C5)C6)cc4)c(OC)c3)S2)cc1 |
| InChI | InChI=1S/C36H37N3O5S/c1-42-29-10-8-28(9-11-29)38-35-39-34(41)32(45-35)17-22-3-12-30(31(16-22)43-2)44-21-33(40)37-27-6-4-26(5-7-27)36-18-23-13-24(19-36)15-25(14-23)20-36/h3-12,16-17,23-25H,13-15,18-21H2,1-2H3,(H,37,40)(H,38,39,41)/b32-17+ |
| InChIKey | UADSQCFSCKTYDL-VTNSRFBWSA-N |
| XLogP | 7.08 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.78 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|