C25H26N2O4 — CID 5498937
N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 5498937) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 5498937 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)C(O)(c2ccccc2)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C25H26N2O4/c1-3-30-22-16-15-19(17-23(22)31-4-2)18-26-27-24(28)25(29,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-18,29H,3-4H2,1-2H3,(H,27,28)/b26-18- |
| InChIKey | LCRBLGQBWNQFDM-ITYLOYPMSA-N |
| XLogP | 3.87 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|