C21H26N2O5 — CID 3612099
N-[[3-ethoxy-4-[3-(2-methoxyphenoxy)propoxy]phenyl]methylideneamino]acetamide (PubChem CID 3612099) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[[3-ethoxy-4-[3-(2-methoxyphenoxy)propoxy]phenyl]methylideneamino]acetamide.
| Compound Name | N-[[3-ethoxy-4-[3-(2-methoxyphenoxy)propoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3612099 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[[3-ethoxy-4-[3-(2-methoxyphenoxy)propoxy]phenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(C=NNC(C)=O)ccc1OCCCOc1ccccc1OC |
| InChI | InChI=1S/C21H26N2O5/c1-4-26-21-14-17(15-22-23-16(2)24)10-11-20(21)28-13-7-12-27-19-9-6-5-8-18(19)25-3/h5-6,8-11,14-15H,4,7,12-13H2,1-3H3,(H,23,24) |
| InChIKey | UTEPRLNGJSDNHR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|