C20H25N3O5 — CID 5036954
[[3-ethoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]urea (PubChem CID 5036954) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is [[3-ethoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]urea.
| Compound Name | [[3-ethoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 5036954 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | [[3-ethoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylideneamino]urea |
| SMILES | CCOc1cc(C=NNC(N)=O)ccc1OCCCOc1cccc(OC)c1 |
| InChI | InChI=1S/C20H25N3O5/c1-3-26-19-12-15(14-22-23-20(21)24)8-9-18(19)28-11-5-10-27-17-7-4-6-16(13-17)25-2/h4,6-9,12-14H,3,5,10-11H2,1-2H3,(H3,21,23,24) |
| InChIKey | HDBUWXWBEKEAKN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|