C21H26ClN3O4 — CID 4692458
[[4-[3-(4-chloro-3,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylideneamino]urea (PubChem CID 4692458) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is [[4-[3-(4-chloro-3,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylideneamino]urea.
| Compound Name | [[4-[3-(4-chloro-3,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 4692458 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [[4-[3-(4-chloro-3,5-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylideneamino]urea |
| SMILES | CCOc1cc(C=NNC(N)=O)ccc1OCCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C21H26ClN3O4/c1-4-27-19-12-16(13-24-25-21(23)26)6-7-18(19)29-9-5-8-28-17-10-14(2)20(22)15(3)11-17/h6-7,10-13H,4-5,8-9H2,1-3H3,(H3,23,25,26) |
| InChIKey | FGUFUQZSYHUQTI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|