C40H41N3O5 — CID 126019561
N-[(E)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-(4-phenylphenoxy)acetamide (PubChem CID 126019561) has the molecular formula C40H41N3O5 and a molecular weight of 643.78 g/mol. Its IUPAC name is N-[(E)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[(E)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 126019561 |
| Molecular Formula | C40H41N3O5 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | N-[(E)-[4-[2-[4-(1-adamantyl)anilino]-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]-2-(4-phenylphenoxy)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)COc2ccc(-c3ccccc3)cc2)ccc1OCC(=O)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C40H41N3O5/c1-46-37-20-27(24-41-43-39(45)26-47-35-14-8-32(9-15-35)31-5-3-2-4-6-31)7-16-36(37)48-25-38(44)42-34-12-10-33(11-13-34)40-21-28-17-29(22-40)19-30(18-28)23-40/h2-16,20,24,28-30H,17-19,21-23,25-26H2,1H3,(H,42,44)(H,43,45)/b41-24+ |
| InChIKey | LRWMPPFNXOOTSR-JBZNKQRISA-N |
| XLogP | 7.38 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|