C35H39N5O4 — CID 126011199
N-[4-(1-adamantyl)phenyl]-2-[4-[(E)-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetamide (PubChem CID 126011199) has the molecular formula C35H39N5O4 and a molecular weight of 593.73 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-2-[4-[(E)-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-2-[4-[(E)-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126011199 |
| Molecular Formula | C35H39N5O4 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-2-[4-[(E)-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]hydrazinylidene]methyl]-2-methoxyphenoxy]acetamide |
| SMILES | COCc1cc(C)nc(N/N=C/c2ccc(OCC(=O)Nc3ccc(C45CC6CC(CC(C6)C4)C5)cc3)c(OC)c2)c1C#N |
| InChI | InChI=1S/C35H39N5O4/c1-22-10-27(20-42-2)30(18-36)34(38-22)40-37-19-23-4-9-31(32(14-23)43-3)44-21-33(41)39-29-7-5-28(6-8-29)35-15-24-11-25(16-35)13-26(12-24)17-35/h4-10,14,19,24-26H,11-13,15-17,20-21H2,1-3H3,(H,38,40)(H,39,41)/b37-19+ |
| InChIKey | APSIPKOTQZPEIA-SAEPALGJSA-N |
| XLogP | 6.35 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|