C27H26N6O8 — CID 126072276
2-[4-[(E)-[[2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126072276) has the molecular formula C27H26N6O8 and a molecular weight of 562.54 g/mol. Its IUPAC name is 2-[4-[(E)-[[2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[4-[(E)-[[2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126072276 |
| Molecular Formula | C27H26N6O8 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 2-[4-[(E)-[[2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetyl]hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | COCc1cc(C)nc(OCC(=O)N/N=C/c2ccc(OCC(=O)Nc3cccc([N+](=O)[O-])c3)c(OC)c2)c1C#N |
| InChI | InChI=1S/C27H26N6O8/c1-17-9-19(14-38-2)22(12-28)27(30-17)41-16-26(35)32-29-13-18-7-8-23(24(10-18)39-3)40-15-25(34)31-20-5-4-6-21(11-20)33(36)37/h4-11,13H,14-16H2,1-3H3,(H,31,34)(H,32,35)/b29-13+ |
| InChIKey | VDNPKWRQNSPFQN-VFLNYLIXSA-N |
| XLogP | 2.87 |
| TPSA | 187.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|