C27H26BrN5O7 — CID 124544304
2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 124544304) has the molecular formula C27H26BrN5O7 and a molecular weight of 612.44 g/mol. Its IUPAC name is 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124544304 |
| Molecular Formula | C27H26BrN5O7 |
| Molecular Weight | 612.44 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)COc2nc(C)c(Br)c(COC)c2C#N)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H26BrN5O7/c1-4-38-24-11-19(7-10-23(24)39-14-18-5-8-20(9-6-18)33(35)36)13-30-32-25(34)16-40-27-21(12-29)22(15-37-3)26(28)17(2)31-27/h5-11,13H,4,14-16H2,1-3H3,(H,32,34)/b30-13- |
| InChIKey | DEPPPBDKZRPTSF-YNFMAFFXSA-N |
| XLogP | 4.59 |
| TPSA | 158.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|