C26H24BrN5O7 — CID 98119921
2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 98119921) has the molecular formula C26H24BrN5O7 and a molecular weight of 598.41 g/mol. Its IUPAC name is 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98119921 |
| Molecular Formula | C26H24BrN5O7 |
| Molecular Weight | 598.41 g/mol |
| Exact Mass | 597.09 |
| IUPAC Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | COCc1c(Br)c(C)nc(OCC(=O)N/N=C\c2ccc(OCc3ccc([N+](=O)[O-])cc3)c(OC)c2)c1C#N |
| InChI | InChI=1S/C26H24BrN5O7/c1-16-25(27)21(14-36-2)20(11-28)26(30-16)39-15-24(33)31-29-12-18-6-9-22(23(10-18)37-3)38-13-17-4-7-19(8-5-17)32(34)35/h4-10,12H,13-15H2,1-3H3,(H,31,33)/b29-12- |
| InChIKey | NMYKWGPFXZNFMY-ULPWCQAASA-N |
| XLogP | 4.20 |
| TPSA | 158.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|