C26H23BrClIN4O5 — CID 124601780
2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide (PubChem CID 124601780) has the molecular formula C26H23BrClIN4O5 and a molecular weight of 713.75 g/mol. Its IUPAC name is 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124601780 |
| Molecular Formula | C26H23BrClIN4O5 |
| Molecular Weight | 713.75 g/mol |
| Exact Mass | 711.96 |
| IUPAC Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COCc1c(Br)c(C)nc(OCC(=O)N/N=C\c2cc(I)c(OCc3ccc(Cl)cc3)c(OC)c2)c1C#N |
| InChI | InChI=1S/C26H23BrClIN4O5/c1-15-24(27)20(13-35-2)19(10-30)26(32-15)38-14-23(34)33-31-11-17-8-21(29)25(22(9-17)36-3)37-12-16-4-6-18(28)7-5-16/h4-9,11H,12-14H2,1-3H3,(H,33,34)/b31-11- |
| InChIKey | AEPMJFSOUCGXNK-VWDPFFEDSA-N |
| XLogP | 5.55 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.75 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|