C23H19BrN6O6 — CID 126199740
2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]acetamide (PubChem CID 126199740) has the molecular formula C23H19BrN6O6 and a molecular weight of 555.35 g/mol. Its IUPAC name is 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126199740 |
| Molecular Formula | C23H19BrN6O6 |
| Molecular Weight | 555.35 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(E)-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]acetamide |
| SMILES | COCc1c(Br)c(C)nc(OCC(=O)N/N=C/c2ccc(Oc3ccc([N+](=O)[O-])cn3)cc2)c1C#N |
| InChI | InChI=1S/C23H19BrN6O6/c1-14-22(24)19(12-34-2)18(9-25)23(28-14)35-13-20(31)29-27-10-15-3-6-17(7-4-15)36-21-8-5-16(11-26-21)30(32)33/h3-8,10-11H,12-13H2,1-2H3,(H,29,31)/b27-10+ |
| InChIKey | FARFLPILKKGJBD-YPXUMCKCSA-N |
| XLogP | 3.80 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|