C22H17BrClN5O6 — CID 98119935
2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 98119935) has the molecular formula C22H17BrClN5O6 and a molecular weight of 562.76 g/mol. Its IUPAC name is 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98119935 |
| Molecular Formula | C22H17BrClN5O6 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 561.01 |
| IUPAC Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | COCc1c(Br)c(C)nc(OCC(=O)N/N=C\c2ccc(-c3ccc(Cl)cc3[N+](=O)[O-])o2)c1C#N |
| InChI | InChI=1S/C22H17BrClN5O6/c1-12-21(23)17(10-33-2)16(8-25)22(27-12)34-11-20(30)28-26-9-14-4-6-19(35-14)15-5-3-13(24)7-18(15)29(31)32/h3-7,9H,10-11H2,1-2H3,(H,28,30)/b26-9- |
| InChIKey | VOIFFJMLEPSXQT-WMDMUMDLSA-N |
| XLogP | 4.52 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|