C22H19BrN4O4 — CID 5437217
N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide (PubChem CID 5437217) has the molecular formula C22H19BrN4O4 and a molecular weight of 483.32 g/mol. Its IUPAC name is N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide.
| Compound Name | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide |
|---|---|
| PubChem CID | 5437217 |
| Molecular Formula | C22H19BrN4O4 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide |
| SMILES | COCc1cc(C)nc(OCC(=O)N/N=C\c2ccc(-c3ccc(Br)cc3)o2)c1C#N |
| InChI | InChI=1S/C22H19BrN4O4/c1-14-9-16(12-29-2)19(10-24)22(26-14)30-13-21(28)27-25-11-18-7-8-20(31-18)15-3-5-17(23)6-4-15/h3-9,11H,12-13H2,1-2H3,(H,27,28)/b25-11- |
| InChIKey | KMCDYUBTRRPHJV-GATIEOLUSA-N |
| XLogP | 3.96 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|