C18H16Br2N4O4 — CID 137171995
2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 137171995) has the molecular formula C18H16Br2N4O4 and a molecular weight of 512.16 g/mol. Its IUPAC name is 2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137171995 |
| Molecular Formula | C18H16Br2N4O4 |
| Molecular Weight | 512.16 g/mol |
| Exact Mass | 509.95 |
| IUPAC Name | 2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | COCc1cc(C)nc(OCC(=O)N/N=C\c2cc(Br)cc(Br)c2O)c1C#N |
| InChI | InChI=1S/C18H16Br2N4O4/c1-10-3-12(8-27-2)14(6-21)18(23-10)28-9-16(25)24-22-7-11-4-13(19)5-15(20)17(11)26/h3-5,7,26H,8-9H2,1-2H3,(H,24,25)/b22-7- |
| InChIKey | YIBJFXPKPBLLQN-HOEBFWFUSA-N |
| XLogP | 3.17 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|