C19H19BrN4O5 — CID 136752796
N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide (PubChem CID 136752796) has the molecular formula C19H19BrN4O5 and a molecular weight of 463.29 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide.
| Compound Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide |
|---|---|
| PubChem CID | 136752796 |
| Molecular Formula | C19H19BrN4O5 |
| Molecular Weight | 463.29 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide |
| SMILES | COCc1cc(C)nc(OCC(=O)N/N=C\c2cc(Br)c(O)c(OC)c2)c1C#N |
| InChI | InChI=1S/C19H19BrN4O5/c1-11-4-13(9-27-2)14(7-21)19(23-11)29-10-17(25)24-22-8-12-5-15(20)18(26)16(6-12)28-3/h4-6,8,26H,9-10H2,1-3H3,(H,24,25)/b22-8- |
| InChIKey | SRNJOBKWAKMCMK-UYOCIXKTSA-N |
| XLogP | 2.41 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|