C19H18Br2N4O4 — CID 5440465
2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]acetamide (PubChem CID 5440465) has the molecular formula C19H18Br2N4O4 and a molecular weight of 526.19 g/mol. Its IUPAC name is 2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5440465 |
| Molecular Formula | C19H18Br2N4O4 |
| Molecular Weight | 526.19 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | 2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-(3,5-dibromo-4-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COCc1cc(C)nc(OCC(=O)N/N=C\c2cc(Br)c(OC)c(Br)c2)c1C#N |
| InChI | InChI=1S/C19H18Br2N4O4/c1-11-4-13(9-27-2)14(7-22)19(24-11)29-10-17(26)25-23-8-12-5-15(20)18(28-3)16(21)6-12/h4-6,8H,9-10H2,1-3H3,(H,25,26)/b23-8- |
| InChIKey | QAWRSNLPHNJDNE-NYAPKIOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|