C11H11N2O4- — CID 7228435
2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetate (PubChem CID 7228435) has the molecular formula C11H11N2O4- and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetate.
| Compound Name | 2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 7228435 |
| Molecular Formula | C11H11N2O4- |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-[[3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetate |
| SMILES | COCc1cc(C)nc(OCC(=O)[O-])c1C#N |
| InChI | InChI=1S/C11H12N2O4/c1-7-3-8(5-16-2)9(4-12)11(13-7)17-6-10(14)15/h3H,5-6H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | VYDSZOKEUUDMPG-UHFFFAOYSA-M |
| XLogP | -0.46 |
| TPSA | 95.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |