C24H22N4O6 — CID 126011575
methyl 4-[5-[(E)-[[2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 126011575) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is methyl 4-[5-[(E)-[[2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(E)-[[2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126011575 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | methyl 4-[5-[(E)-[[2-[3-cyano-4-(methoxymethyl)-6-methyl-2-oxo-1-pyridinyl]acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | COCc1cc(C)n(CC(=O)N/N=C/c2ccc(-c3ccc(C(=O)OC)cc3)o2)c(=O)c1C#N |
| InChI | InChI=1S/C24H22N4O6/c1-15-10-18(14-32-2)20(11-25)23(30)28(15)13-22(29)27-26-12-19-8-9-21(34-19)16-4-6-17(7-5-16)24(31)33-3/h4-10,12H,13-14H2,1-3H3,(H,27,29)/b26-12+ |
| InChIKey | BUMRACJWMPBLSS-RPPGKUMJSA-N |
| XLogP | 2.37 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|