C22H18BrN5O6 — CID 98710372
2-[3-bromo-5-cyano-4-(methoxymethyl)-2-methyl-6-oxo-1-pyridinyl]-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 98710372) has the molecular formula C22H18BrN5O6 and a molecular weight of 528.32 g/mol. Its IUPAC name is 2-[3-bromo-5-cyano-4-(methoxymethyl)-2-methyl-6-oxo-1-pyridinyl]-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-[3-bromo-5-cyano-4-(methoxymethyl)-2-methyl-6-oxo-1-pyridinyl]-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98710372 |
| Molecular Formula | C22H18BrN5O6 |
| Molecular Weight | 528.32 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | 2-[3-bromo-5-cyano-4-(methoxymethyl)-2-methyl-6-oxo-1-pyridinyl]-N-[(Z)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | COCc1c(Br)c(C)n(CC(=O)N/N=C\c2ccc(-c3cccc([N+](=O)[O-])c3)o2)c(=O)c1C#N |
| InChI | InChI=1S/C22H18BrN5O6/c1-13-21(23)18(12-33-2)17(9-24)22(30)27(13)11-20(29)26-25-10-16-6-7-19(34-16)14-4-3-5-15(8-14)28(31)32/h3-8,10H,11-12H2,1-2H3,(H,26,29)/b25-10- |
| InChIKey | HDGXOXAYGBVBTO-MRUKODCESA-N |
| XLogP | 3.26 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|