C22H19N3O6 — CID 94846269
ethyl 3-[5-[(Z)-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 94846269) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is ethyl 3-[5-[(Z)-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 3-[5-[(Z)-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 94846269 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | ethyl 3-[5-[(Z)-[[2-(4-nitrophenyl)acetyl]hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccc(/C=N\NC(=O)Cc3ccc([N+](=O)[O-])cc3)o2)c1 |
| InChI | InChI=1S/C22H19N3O6/c1-2-30-22(27)17-5-3-4-16(13-17)20-11-10-19(31-20)14-23-24-21(26)12-15-6-8-18(9-7-15)25(28)29/h3-11,13-14H,2,12H2,1H3,(H,24,26)/b23-14- |
| InChIKey | NQAKWPMPOIOMNX-UCQKPKSFSA-N |
| XLogP | 3.72 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|