C22H19N3O7 — CID 126184157
ethyl 3-[5-[(Z)-[(2-methoxy-5-nitrobenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 126184157) has the molecular formula C22H19N3O7 and a molecular weight of 437.41 g/mol. Its IUPAC name is ethyl 3-[5-[(Z)-[(2-methoxy-5-nitrobenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 3-[5-[(Z)-[(2-methoxy-5-nitrobenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126184157 |
| Molecular Formula | C22H19N3O7 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | ethyl 3-[5-[(Z)-[(2-methoxy-5-nitrobenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccc(/C=N\NC(=O)c3cc([N+](=O)[O-])ccc3OC)o2)c1 |
| InChI | InChI=1S/C22H19N3O7/c1-3-31-22(27)15-6-4-5-14(11-15)19-10-8-17(32-19)13-23-24-21(26)18-12-16(25(28)29)7-9-20(18)30-2/h4-13H,3H2,1-2H3,(H,24,26)/b23-13- |
| InChIKey | JBEYJRDKHFVZTK-QRVIBDJDSA-N |
| XLogP | 3.80 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|