C20H17N3O5 — CID 6298177
2-methoxy-N-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 6298177) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is 2-methoxy-N-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 2-methoxy-N-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6298177 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-methoxy-N-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | COc1ccccc1C(=O)N/N=C\c1ccc(-c2cc([N+](=O)[O-])ccc2C)o1 |
| InChI | InChI=1S/C20H17N3O5/c1-13-7-8-14(23(25)26)11-17(13)19-10-9-15(28-19)12-21-22-20(24)16-5-3-4-6-18(16)27-2/h3-12H,1-2H3,(H,22,24)/b21-12- |
| InChIKey | PRIPFWWRVXJZCI-MTJSOVHGSA-N |
| XLogP | 3.94 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|