C20H14F3N3O4 — CID 21211166
N-[(E)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 21211166) has the molecular formula C20H14F3N3O4 and a molecular weight of 417.34 g/mol. Its IUPAC name is N-[(E)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(E)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 21211166 |
| Molecular Formula | C20H14F3N3O4 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-[(E)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1ccc(/C=N/NC(=O)c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C20H14F3N3O4/c1-12-5-6-15(26(28)29)10-17(12)18-8-7-16(30-18)11-24-25-19(27)13-3-2-4-14(9-13)20(21,22)23/h2-11H,1H3,(H,25,27)/b24-11+ |
| InChIKey | CHSTYCDUQSGSKY-BHGWPJFGSA-N |
| XLogP | 4.95 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|