C25H17N3O5 — CID 5455678
N-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide (PubChem CID 5455678) has the molecular formula C25H17N3O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is N-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 5455678 |
| Molecular Formula | C25H17N3O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]benzo[e][1]benzofuran-2-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1ccc(/C=N\NC(=O)c2cc3c(ccc4ccccc43)o2)o1 |
| InChI | InChI=1S/C25H17N3O5/c1-15-6-8-17(28(30)31)12-20(15)22-11-9-18(32-22)14-26-27-25(29)24-13-21-19-5-3-2-4-16(19)7-10-23(21)33-24/h2-14H,1H3,(H,27,29)/b26-14- |
| InChIKey | LFTIXZZEYOCEIE-WGARJPEWSA-N |
| XLogP | 5.83 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|