C20H14N2O2 — CID 11995312
N-[(E)-benzylideneamino]benzo[e][1]benzofuran-2-carboxamide (PubChem CID 11995312) has the molecular formula C20H14N2O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]benzo[e][1]benzofuran-2-carboxamide.
| Compound Name | N-[(E)-benzylideneamino]benzo[e][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 11995312 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[(E)-benzylideneamino]benzo[e][1]benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1)c1cc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C20H14N2O2/c23-20(22-21-13-14-6-2-1-3-7-14)19-12-17-16-9-5-4-8-15(16)10-11-18(17)24-19/h1-13H,(H,22,23)/b21-13+ |
| InChIKey | BCTHKTSDBOZSRZ-FYJGNVAPSA-N |
| XLogP | 4.35 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|