C22H16CuN2O2+2 — CID 86575254
copper N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzo[e][1]benzofuran-2-carboxamide (PubChem CID 86575254) has the molecular formula C22H16CuN2O2+2 and a molecular weight of 403.93 g/mol. Its IUPAC name is copper N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzo[e][1]benzofuran-2-carboxamide.
| Compound Name | copper N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzo[e][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 86575254 |
| Molecular Formula | C22H16CuN2O2+2 |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | copper N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]benzo[e][1]benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C/C=C/c1ccccc1)c1cc2c(ccc3ccccc32)o1.[Cu+2] |
| InChI | InChI=1S/C22H16N2O2.Cu/c25-22(24-23-14-6-9-16-7-2-1-3-8-16)21-15-19-18-11-5-4-10-17(18)12-13-20(19)26-21;/h1-15H,(H,24,25);/q;+2/b9-6+,23-14+; |
| InChIKey | KNBCVKMSFGNVLD-RZSXACAVSA-N |
| XLogP | 5.01 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|