C22H16N2O4 — CID 73254287
methyl 4-[(E)-(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]benzoate (PubChem CID 73254287) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is methyl 4-[(E)-(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]benzoate.
| Compound Name | methyl 4-[(E)-(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]benzoate |
|---|---|
| PubChem CID | 73254287 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl 4-[(E)-(benzo[e][1]benzofuran-2-carbonylhydrazinylidene)methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/NC(=O)c2cc3c(ccc4ccccc43)o2)cc1 |
| InChI | InChI=1S/C22H16N2O4/c1-27-22(26)16-8-6-14(7-9-16)13-23-24-21(25)20-12-18-17-5-3-2-4-15(17)10-11-19(18)28-20/h2-13H,1H3,(H,24,25)/b23-13+ |
| InChIKey | LGZYXXSXSZMFHW-YDZHTSKRSA-N |
| XLogP | 4.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|