C19H13Cl2N3O5 — CID 126229875
N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-methoxy-5-nitrobenzamide (PubChem CID 126229875) has the molecular formula C19H13Cl2N3O5 and a molecular weight of 434.24 g/mol. Its IUPAC name is N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-methoxy-5-nitrobenzamide.
| Compound Name | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-methoxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 126229875 |
| Molecular Formula | C19H13Cl2N3O5 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-methoxy-5-nitrobenzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)N/N=C\c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C19H13Cl2N3O5/c1-28-17-6-3-12(24(26)27)9-15(17)19(25)23-22-10-13-4-7-18(29-13)14-5-2-11(20)8-16(14)21/h2-10H,1H3,(H,23,25)/b22-10- |
| InChIKey | GXUMPFOVSUOBFT-YVNNLAQVSA-N |
| XLogP | 4.93 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|