C19H14ClN3O5 — CID 1041488
N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-4-nitrobenzamide (PubChem CID 1041488) has the molecular formula C19H14ClN3O5 and a molecular weight of 399.79 g/mol. Its IUPAC name is N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 1041488 |
| Molecular Formula | C19H14ClN3O5 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-4-nitrobenzamide |
| SMILES | COc1ccc(-c2ccc(C=NNC(=O)c3ccc([N+](=O)[O-])cc3)o2)cc1Cl |
| InChI | InChI=1S/C19H14ClN3O5/c1-27-18-8-4-13(10-16(18)20)17-9-7-15(28-17)11-21-22-19(24)12-2-5-14(6-3-12)23(25)26/h2-11H,1H3,(H,22,24) |
| InChIKey | LAAVFQLNRUZITD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|