C22H18BrClN4O4 — CID 92847226
2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 92847226) has the molecular formula C22H18BrClN4O4 and a molecular weight of 517.77 g/mol. Its IUPAC name is 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 92847226 |
| Molecular Formula | C22H18BrClN4O4 |
| Molecular Weight | 517.77 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | COCc1c(Br)c(C)nc(OCC(=O)N/N=C\c2ccc(-c3ccc(Cl)cc3)o2)c1C#N |
| InChI | InChI=1S/C22H18BrClN4O4/c1-13-21(23)18(11-30-2)17(9-25)22(27-13)31-12-20(29)28-26-10-16-7-8-19(32-16)14-3-5-15(24)6-4-14/h3-8,10H,11-12H2,1-2H3,(H,28,29)/b26-10- |
| InChIKey | OSARXOHQPPFRDB-KALUYTGESA-N |
| XLogP | 4.61 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|