C20H15BrN4O5 — CID 56697492
2-bromo-N-[2-[(2E)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 56697492) has the molecular formula C20H15BrN4O5 and a molecular weight of 471.27 g/mol. Its IUPAC name is 2-bromo-N-[2-[(2E)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2-bromo-N-[2-[(2E)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 56697492 |
| Molecular Formula | C20H15BrN4O5 |
| Molecular Weight | 471.27 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 2-bromo-N-[2-[(2E)-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Br)N/N=C/c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C20H15BrN4O5/c21-17-7-2-1-6-16(17)20(27)22-12-19(26)24-23-11-15-8-9-18(30-15)13-4-3-5-14(10-13)25(28)29/h1-11H,12H2,(H,22,27)(H,24,26)/b23-11+ |
| InChIKey | YUUGKZTWRQCIGH-FOKLQQMPSA-N |
| XLogP | 3.50 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|