C12H10N4O3S — CID 691890
[[5-(3-nitrophenyl)furan-2-yl]methylideneamino]thiourea (PubChem CID 691890) has the molecular formula C12H10N4O3S and a molecular weight of 290.30 g/mol. Its IUPAC name is [[5-(3-nitrophenyl)furan-2-yl]methylideneamino]thiourea.
| Compound Name | [[5-(3-nitrophenyl)furan-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 691890 |
| Molecular Formula | C12H10N4O3S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [[5-(3-nitrophenyl)furan-2-yl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C12H10N4O3S/c13-12(20)15-14-7-10-4-5-11(19-10)8-2-1-3-9(6-8)16(17)18/h1-7H,(H3,13,15,20) |
| InChIKey | QXBHVMNLTVALLC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|