C13H13N4O3+ — CID 89247186
[3-[5-[(E)-(carbamoylhydrazinylidene)methyl]furan-2-yl]phenyl]-methyl-oxoazanium (PubChem CID 89247186) has the molecular formula C13H13N4O3+ and a molecular weight of 273.27 g/mol. Its IUPAC name is [3-[5-[(E)-(carbamoylhydrazinylidene)methyl]furan-2-yl]phenyl]-methyl-oxoazanium.
| Compound Name | [3-[5-[(E)-(carbamoylhydrazinylidene)methyl]furan-2-yl]phenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 89247186 |
| Molecular Formula | C13H13N4O3+ |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [3-[5-[(E)-(carbamoylhydrazinylidene)methyl]furan-2-yl]phenyl]-methyl-oxoazanium |
| SMILES | C[N+](=O)c1cccc(-c2ccc(/C=N/NC(N)=O)o2)c1 |
| InChI | InChI=1S/C13H12N4O3/c1-17(19)10-4-2-3-9(7-10)12-6-5-11(20-12)8-15-16-13(14)18/h2-8H,1H3,(H2-,14,16,18)/p+1/b15-8+ |
| InChIKey | KWCWKKLPAZPDER-OVCLIPMQSA-O |
| XLogP | 1.99 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|