C8H10N6O3 — CID 14174868
[(E)-[5-[(E)-(carbamoylhydrazinylidene)methyl]furan-2-yl]methylideneamino]urea (PubChem CID 14174868) has the molecular formula C8H10N6O3 and a molecular weight of 238.21 g/mol. Its IUPAC name is [(E)-[5-[(E)-(carbamoylhydrazinylidene)methyl]furan-2-yl]methylideneamino]urea.
| Compound Name | [(E)-[5-[(E)-(carbamoylhydrazinylidene)methyl]furan-2-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 14174868 |
| Molecular Formula | C8H10N6O3 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [(E)-[5-[(E)-(carbamoylhydrazinylidene)methyl]furan-2-yl]methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1ccc(/C=N/NC(N)=O)o1 |
| InChI | InChI=1S/C8H10N6O3/c9-7(15)13-11-3-5-1-2-6(17-5)4-12-14-8(10)16/h1-4H,(H3,9,13,15)(H3,10,14,16)/b11-3+,12-4+ |
| InChIKey | JRZXJZPIBZCOLH-HMMKTVFPSA-N |
| XLogP | -0.72 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|