C6H8N4O2 — CID 5396872
[(Z)-(5-aminofuran-2-yl)methylideneamino]urea (PubChem CID 5396872) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is [(Z)-(5-aminofuran-2-yl)methylideneamino]urea.
| Compound Name | [(Z)-(5-aminofuran-2-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 5396872 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | [(Z)-(5-aminofuran-2-yl)methylideneamino]urea |
| SMILES | NC(=O)N/N=C\c1ccc(N)o1 |
| InChI | InChI=1S/C6H8N4O2/c7-5-2-1-4(12-5)3-9-10-6(8)11/h1-3H,7H2,(H3,8,10,11)/b9-3- |
| InChIKey | WIDJXWNKORRSLM-OQFOIZHKSA-N |
| XLogP | -0.14 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|