C9H14N4O4S — CID 133225233
[(E)-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]methylideneamino]urea (PubChem CID 133225233) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is [(E)-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]methylideneamino]urea.
| Compound Name | [(E)-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 133225233 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | [(E)-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]methylideneamino]urea |
| SMILES | CN(Cc1ccc(/C=N/NC(N)=O)o1)S(C)(=O)=O |
| InChI | InChI=1S/C9H14N4O4S/c1-13(18(2,15)16)6-8-4-3-7(17-8)5-11-12-9(10)14/h3-5H,6H2,1-2H3,(H3,10,12,14)/b11-5+ |
| InChIKey | KDALSIRRQNGFPS-VZUCSPMQSA-N |
| XLogP | -0.33 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|