C9H14N4O3S2 — CID 99972923
[(Z)-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]methylideneamino]thiourea (PubChem CID 99972923) has the molecular formula C9H14N4O3S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is [(Z)-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]methylideneamino]thiourea.
| Compound Name | [(Z)-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 99972923 |
| Molecular Formula | C9H14N4O3S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [(Z)-[5-[[methyl(methylsulfonyl)amino]methyl]furan-2-yl]methylideneamino]thiourea |
| SMILES | CN(Cc1ccc(/C=N\NC(N)=S)o1)S(C)(=O)=O |
| InChI | InChI=1S/C9H14N4O3S2/c1-13(18(2,14)15)6-8-4-3-7(16-8)5-11-12-9(10)17/h3-5H,6H2,1-2H3,(H3,10,12,17)/b11-5- |
| InChIKey | QJFKTAMFCIBKEP-WZUFQYTHSA-N |
| XLogP | -0.16 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|