C14H22N4S — CID 168534598
[[4-[[butyl(methyl)amino]methyl]phenyl]methylideneamino]thiourea (PubChem CID 168534598) has the molecular formula C14H22N4S and a molecular weight of 278.43 g/mol. Its IUPAC name is [[4-[[butyl(methyl)amino]methyl]phenyl]methylideneamino]thiourea.
| Compound Name | [[4-[[butyl(methyl)amino]methyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168534598 |
| Molecular Formula | C14H22N4S |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [[4-[[butyl(methyl)amino]methyl]phenyl]methylideneamino]thiourea |
| SMILES | CCCCN(C)Cc1ccc(C=NNC(N)=S)cc1 |
| InChI | InChI=1S/C14H22N4S/c1-3-4-9-18(2)11-13-7-5-12(6-8-13)10-16-17-14(15)19/h5-8,10H,3-4,9,11H2,1-2H3,(H3,15,17,19) |
| InChIKey | HMZIPZBPWHZMGF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|