C12H16Cl2N4S — CID 6109681
[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]thiourea (PubChem CID 6109681) has the molecular formula C12H16Cl2N4S and a molecular weight of 319.26 g/mol. Its IUPAC name is [(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]thiourea.
| Compound Name | [(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6109681 |
| Molecular Formula | C12H16Cl2N4S |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | [(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C\c1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C12H16Cl2N4S/c13-5-7-18(8-6-14)11-3-1-10(2-4-11)9-16-17-12(15)19/h1-4,9H,5-8H2,(H3,15,17,19)/b16-9- |
| InChIKey | YOLBRZBUSXEONX-SXGWCWSVSA-N |
| XLogP | 2.14 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|