C18H19Cl2N3O — CID 6187802
N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]benzamide (PubChem CID 6187802) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]benzamide.
| Compound Name | N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6187802 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(N(CCCl)CCCl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H19Cl2N3O/c19-10-12-23(13-11-20)17-8-6-15(7-9-17)14-21-22-18(24)16-4-2-1-3-5-16/h1-9,14H,10-13H2,(H,22,24)/b21-14- |
| InChIKey | OOHDQWHCBQDUDI-STZFKDTASA-N |
| XLogP | 3.73 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|