C13H18Cl3N7 — CID 54609584
3-N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 54609584) has the molecular formula C13H18Cl3N7 and a molecular weight of 378.70 g/mol. Its IUPAC name is 3-N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 54609584 |
| Molecular Formula | C13H18Cl3N7 |
| Molecular Weight | 378.70 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3-N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | Cl.Nn1cnnc1N/N=C\c1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C13H17Cl2N7.ClH/c14-5-7-21(8-6-15)12-3-1-11(2-4-12)9-17-19-13-20-18-10-22(13)16;/h1-4,9-10H,5-8,16H2,(H,19,20);1H/b17-9-; |
| InChIKey | AFRFJJXOHDRSTB-WPTDRQDKSA-N |
| XLogP | 2.14 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.70 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|