C10H12N6O2 — CID 4296551
4-[[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 4296551) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 4-[[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 4296551 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-[[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(C=NNc2nncn2N)ccc1O |
| InChI | InChI=1S/C10H12N6O2/c1-18-9-4-7(2-3-8(9)17)5-12-14-10-15-13-6-16(10)11/h2-6,17H,11H2,1H3,(H,14,15) |
| InChIKey | FGPLATJLEYOPOT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|