C11H10N6O3S — CID 16765451
5-[(E)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-7-methoxy-1,3-benzoxathiol-2-one (PubChem CID 16765451) has the molecular formula C11H10N6O3S and a molecular weight of 306.31 g/mol. Its IUPAC name is 5-[(E)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-7-methoxy-1,3-benzoxathiol-2-one.
| Compound Name | 5-[(E)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-7-methoxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 16765451 |
| Molecular Formula | C11H10N6O3S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5-[(E)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-7-methoxy-1,3-benzoxathiol-2-one |
| SMILES | COc1cc(/C=N/Nc2nncn2N)cc2sc(=O)oc12 |
| InChI | InChI=1S/C11H10N6O3S/c1-19-7-2-6(3-8-9(7)20-11(18)21-8)4-13-15-10-16-14-5-17(10)12/h2-5H,12H2,1H3,(H,15,16)/b13-4+ |
| InChIKey | BWKCTWGPVUGHRH-YIXHJXPBSA-N |
| XLogP | 0.61 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_carbonate_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|