C7H8N6O — CID 18529428
3-N-[(E)-furan-2-ylmethylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 18529428) has the molecular formula C7H8N6O and a molecular weight of 192.18 g/mol. Its IUPAC name is 3-N-[(E)-furan-2-ylmethylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(E)-furan-2-ylmethylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 18529428 |
| Molecular Formula | C7H8N6O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3-N-[(E)-furan-2-ylmethylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1cnnc1N/N=C/c1ccco1 |
| InChI | InChI=1S/C7H8N6O/c8-13-5-10-12-7(13)11-9-4-6-2-1-3-14-6/h1-5H,8H2,(H,11,12)/b9-4+ |
| InChIKey | KOGMMUVASPFHGQ-RUDMXATFSA-N |
| XLogP | 0.03 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|