C15H15BrN6O — CID 6271481
3-N-[(Z)-[5-(2-bromo-4,5-dimethylphenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 6271481) has the molecular formula C15H15BrN6O and a molecular weight of 375.23 g/mol. Its IUPAC name is 3-N-[(Z)-[5-(2-bromo-4,5-dimethylphenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(Z)-[5-(2-bromo-4,5-dimethylphenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 6271481 |
| Molecular Formula | C15H15BrN6O |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 3-N-[(Z)-[5-(2-bromo-4,5-dimethylphenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1cc(Br)c(-c2ccc(/C=N\Nc3nncn3N)o2)cc1C |
| InChI | InChI=1S/C15H15BrN6O/c1-9-5-12(13(16)6-10(9)2)14-4-3-11(23-14)7-18-20-15-21-19-8-22(15)17/h3-8H,17H2,1-2H3,(H,20,21)/b18-7- |
| InChIKey | RYEYWEZPHOOBQC-WSVATBPTSA-N |
| XLogP | 3.08 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|