C13H12ClN7O3 — CID 18529853
3-N-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 18529853) has the molecular formula C13H12ClN7O3 and a molecular weight of 349.74 g/mol. Its IUPAC name is 3-N-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 18529853 |
| Molecular Formula | C13H12ClN7O3 |
| Molecular Weight | 349.74 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-N-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | Cl.Nn1cnnc1N/N=C/c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C13H11N7O3.ClH/c14-19-8-16-18-13(19)17-15-7-11-4-5-12(23-11)9-2-1-3-10(6-9)20(21)22;/h1-8H,14H2,(H,17,18);1H/b15-7+; |
| InChIKey | NMTWXZBDHUEMMZ-HAZZGOGXSA-N |
| XLogP | 2.03 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.74 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|