C24H14Cl2N8O6 — CID 54586724
N-[(E)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-4-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazol-3-amine (PubChem CID 54586724) has the molecular formula C24H14Cl2N8O6 and a molecular weight of 581.33 g/mol. Its IUPAC name is N-[(E)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-4-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazol-3-amine.
| Compound Name | N-[(E)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-4-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 54586724 |
| Molecular Formula | C24H14Cl2N8O6 |
| Molecular Weight | 581.33 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | N-[(E)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-4-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazol-3-amine |
| SMILES | O=[N+]([O-])c1cc(-c2ccc(/C=N\n3cnnc3N/N=C/c3ccc(-c4ccc(Cl)c([N+](=O)[O-])c4)o3)o2)ccc1Cl |
| InChI | InChI=1S/C24H14Cl2N8O6/c25-18-5-1-14(9-20(18)33(35)36)22-7-3-16(39-22)11-27-30-24-31-28-13-32(24)29-12-17-4-8-23(40-17)15-2-6-19(26)21(10-15)34(37)38/h1-13H,(H,30,31)/b27-11+,29-12- |
| InChIKey | IIUNGHSADDWJGI-SRVUVYNKSA-N |
| XLogP | 6.25 |
| TPSA | 180.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.33 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|