C12H9ClN6O5 — CID 6771045
2-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1-nitroguanidine (PubChem CID 6771045) has the molecular formula C12H9ClN6O5 and a molecular weight of 352.69 g/mol. Its IUPAC name is 2-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1-nitroguanidine.
| Compound Name | 2-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1-nitroguanidine |
|---|---|
| PubChem CID | 6771045 |
| Molecular Formula | C12H9ClN6O5 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-[(Z)-[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylideneamino]-1-nitroguanidine |
| SMILES | NC(=N/N=C\c1ccc(-c2ccc(Cl)c([N+](=O)[O-])c2)o1)N[N+](=O)[O-] |
| InChI | InChI=1S/C12H9ClN6O5/c13-9-3-1-7(5-10(9)18(20)21)11-4-2-8(24-11)6-15-16-12(14)17-19(22)23/h1-6H,(H3,14,16,17)/b15-6- |
| InChIKey | MQTAMCIMQZJDTP-UUASQNMZSA-N |
| XLogP | 1.94 |
| TPSA | 162.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|